C15H23N — CID 11830898
(2Z,4E)-5,9-dimethyl-2-propan-2-yldeca-2,4,8-trienenitrile (PubChem CID 11830898) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (2Z,4E)-5,9-dimethyl-2-propan-2-yldeca-2,4,8-trienenitrile.
| Compound Name | (2Z,4E)-5,9-dimethyl-2-propan-2-yldeca-2,4,8-trienenitrile |
|---|---|
| PubChem CID | 11830898 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (2Z,4E)-5,9-dimethyl-2-propan-2-yldeca-2,4,8-trienenitrile |
| SMILES | CC(C)=CCC/C(C)=C/C=C(\C#N)C(C)C |
| InChI | InChI=1S/C15H23N/c1-12(2)7-6-8-14(5)9-10-15(11-16)13(3)4/h7,9-10,13H,6,8H2,1-5H3/b14-9+,15-10+ |
| InChIKey | MGCHMIBVAYUNEC-AOEKMSOUSA-N |
| XLogP | 4.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|