C15H21NO2 — CID 5357516
ethyl (2Z,4Z)-2-cyano-5,9-dimethyldeca-2,4,8-trienoate (PubChem CID 5357516) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is ethyl (2Z,4Z)-2-cyano-5,9-dimethyldeca-2,4,8-trienoate.
| Compound Name | ethyl (2Z,4Z)-2-cyano-5,9-dimethyldeca-2,4,8-trienoate |
|---|---|
| PubChem CID | 5357516 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | ethyl (2Z,4Z)-2-cyano-5,9-dimethyldeca-2,4,8-trienoate |
| SMILES | CCOC(=O)/C(C#N)=C\C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H21NO2/c1-5-18-15(17)14(11-16)10-9-13(4)8-6-7-12(2)3/h7,9-10H,5-6,8H2,1-4H3/b13-9-,14-10- |
| InChIKey | YJOXFSAPKHSAQY-FOIMCPNXSA-N |
| XLogP | 3.69 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|