C14H20O2 — CID 134918377
ethyl (4E)-5,9-dimethyldeca-4,8-dien-2-ynoate (PubChem CID 134918377) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is ethyl (4E)-5,9-dimethyldeca-4,8-dien-2-ynoate.
| Compound Name | ethyl (4E)-5,9-dimethyldeca-4,8-dien-2-ynoate |
|---|---|
| PubChem CID | 134918377 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | ethyl (4E)-5,9-dimethyldeca-4,8-dien-2-ynoate |
| SMILES | CCOC(=O)C#C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C14H20O2/c1-5-16-14(15)11-7-10-13(4)9-6-8-12(2)3/h8,10H,5-6,9H2,1-4H3/b13-10+ |
| InChIKey | QIDDKMOLQOJOST-JLHYYAGUSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|