C19H32O5 — CID 173435952
acetic acid;ethyl 8-hydroxy-6-methyl-2-(4-methylpent-3-enyl)octa-2,6-dienoate (PubChem CID 173435952) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is acetic acid;ethyl 8-hydroxy-6-methyl-2-(4-methylpent-3-enyl)octa-2,6-dienoate.
| Compound Name | acetic acid;ethyl 8-hydroxy-6-methyl-2-(4-methylpent-3-enyl)octa-2,6-dienoate |
|---|---|
| PubChem CID | 173435952 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | acetic acid;ethyl 8-hydroxy-6-methyl-2-(4-methylpent-3-enyl)octa-2,6-dienoate |
| SMILES | CC(=O)O.CCOC(=O)C(=CCCC(C)=CCO)CCC=C(C)C |
| InChI | InChI=1S/C17H28O3.C2H4O2/c1-5-20-17(19)16(10-6-8-14(2)3)11-7-9-15(4)12-13-18;1-2(3)4/h8,11-12,18H,5-7,9-10,13H2,1-4H3;1H3,(H,3,4) |
| InChIKey | PPBPYJOWUWLPAM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|