About 5-amino-2-methyl-3,4-dioxohexanenitrile
5-amino-2-methyl-3,4-dioxohexanenitrile (PubChem CID 174439405) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-amino-2-methyl-3,4-dioxohexanenitrile.
Molecular Properties
| Compound Name | 5-amino-2-methyl-3,4-dioxohexanenitrile |
| PubChem CID | 174439405 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 5-amino-2-methyl-3,4-dioxohexanenitrile |
| SMILES | CC(N)C(=O)C(=O)C(C)C#N |
| InChI | InChI=1S/C7H10N2O2/c1-4(3-8)6(10)7(11)5(2)9/h4-5H,9H2,1-2H3 |
| InChIKey | OJXAVHHLTVBVAO-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-methyl-3,4-dioxohexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-methyl-3,4-dioxohexanenitrile?
The IUPAC name of 5-amino-2-methyl-3,4-dioxohexanenitrile (CID 174439405) is 5-amino-2-methyl-3,4-dioxohexanenitrile.
What is the SMILES notation for 5-amino-2-methyl-3,4-dioxohexanenitrile?
The canonical SMILES for 5-amino-2-methyl-3,4-dioxohexanenitrile is CC(N)C(=O)C(=O)C(C)C#N.
What is the InChIKey of 5-amino-2-methyl-3,4-dioxohexanenitrile?
The InChIKey is OJXAVHHLTVBVAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4(3-8)6(10)7(11)5(2)9/h4-5H,9H2,1-2H3.
What are the key properties of 5-amino-2-methyl-3,4-dioxohexanenitrile?
5-amino-2-methyl-3,4-dioxohexanenitrile has a molecular weight of 154.17 g/mol, XLogP of -0.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-methyl-3,4-dioxohexanenitrile is sourced from PubChem (CID 174439405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).