About butane;2-cyanopropanoic acid
butane;2-cyanopropanoic acid (PubChem CID 87498788) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is butane;2-cyanopropanoic acid.
Molecular Properties
| Compound Name | butane;2-cyanopropanoic acid |
| PubChem CID | 87498788 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | butane;2-cyanopropanoic acid |
| SMILES | CC(C#N)C(=O)O.CCCC |
| InChI | InChI=1S/C4H5NO2.C4H10/c1-3(2-5)4(6)7;1-3-4-2/h3H,1H3,(H,6,7);3-4H2,1-2H3 |
| InChIKey | PXHSJYBUKRNBMX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;2-cyanopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2-cyanopropanoic acid?
The IUPAC name of butane;2-cyanopropanoic acid (CID 87498788) is butane;2-cyanopropanoic acid.
What is the SMILES notation for butane;2-cyanopropanoic acid?
The canonical SMILES for butane;2-cyanopropanoic acid is CC(C#N)C(=O)O.CCCC.
What is the InChIKey of butane;2-cyanopropanoic acid?
The InChIKey is PXHSJYBUKRNBMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C4H10/c1-3(2-5)4(6)7;1-3-4-2/h3H,1H3,(H,6,7);3-4H2,1-2H3.
What are the key properties of butane;2-cyanopropanoic acid?
butane;2-cyanopropanoic acid has a molecular weight of 157.21 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2-cyanopropanoic acid is sourced from PubChem (CID 87498788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).