About (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile
(2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile (PubChem CID 89273892) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile.
Molecular Properties
| Compound Name | (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile |
| PubChem CID | 89273892 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile |
| SMILES | CC(C)/C(C#N)=C\C1CC1(C)C |
| InChI | InChI=1S/C11H17N/c1-8(2)9(7-12)5-10-6-11(10,3)4/h5,8,10H,6H2,1-4H3/b9-5- |
| InChIKey | XNAUPEZKCOYYCN-UITAMQMPSA-N |
| XLogP | 3.14 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile?
The IUPAC name of (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile (CID 89273892) is (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile.
What is the SMILES notation for (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile?
The canonical SMILES for (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile is CC(C)/C(C#N)=C\C1CC1(C)C.
What is the InChIKey of (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile?
The InChIKey is XNAUPEZKCOYYCN-UITAMQMPSA-N. The full InChI is InChI=1S/C11H17N/c1-8(2)9(7-12)5-10-6-11(10,3)4/h5,8,10H,6H2,1-4H3/b9-5-.
What are the key properties of (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile?
(2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile has a molecular weight of 163.26 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(2,2-dimethylcyclopropyl)methylidene]-3-methylbutanenitrile is sourced from PubChem (CID 89273892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).