C8H15NO — CID 146533192
O-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]hydroxylamine (PubChem CID 146533192) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is O-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]hydroxylamine.
| Compound Name | O-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]hydroxylamine |
|---|---|
| PubChem CID | 146533192 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | O-[(3Z,5Z)-2-methylhepta-3,5-dien-3-yl]hydroxylamine |
| SMILES | C/C=C\C=C(/ON)C(C)C |
| InChI | InChI=1S/C8H15NO/c1-4-5-6-8(10-9)7(2)3/h4-7H,9H2,1-3H3/b5-4-,8-6- |
| InChIKey | RKMFAUHOGMJQNH-NADLECRISA-N |
| XLogP | 1.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|