C10H19NO — CID 134290126
N-[(2Z,4Z)-2-propan-2-ylhexa-2,4-dienoxy]methanamine (PubChem CID 134290126) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is N-[(2Z,4Z)-2-propan-2-ylhexa-2,4-dienoxy]methanamine.
| Compound Name | N-[(2Z,4Z)-2-propan-2-ylhexa-2,4-dienoxy]methanamine |
|---|---|
| PubChem CID | 134290126 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N-[(2Z,4Z)-2-propan-2-ylhexa-2,4-dienoxy]methanamine |
| SMILES | C/C=C\C=C(/CONC)C(C)C |
| InChI | InChI=1S/C10H19NO/c1-5-6-7-10(9(2)3)8-12-11-4/h5-7,9,11H,8H2,1-4H3/b6-5-,10-7+ |
| InChIKey | LPWHQXNBCMLYHR-ZZWPSLBBSA-N |
| XLogP | 2.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|