C13H25N — CID 129103639
(3Z,5Z)-N-ethyl-2-methyl-3-propan-2-ylhepta-3,5-dien-2-amine (PubChem CID 129103639) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (3Z,5Z)-N-ethyl-2-methyl-3-propan-2-ylhepta-3,5-dien-2-amine.
| Compound Name | (3Z,5Z)-N-ethyl-2-methyl-3-propan-2-ylhepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 129103639 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (3Z,5Z)-N-ethyl-2-methyl-3-propan-2-ylhepta-3,5-dien-2-amine |
| SMILES | C/C=C\C=C(\C(C)C)C(C)(C)NCC |
| InChI | InChI=1S/C13H25N/c1-7-9-10-12(11(3)4)13(5,6)14-8-2/h7,9-11,14H,8H2,1-6H3/b9-7-,12-10- |
| InChIKey | DIKXUARVNMARNH-GEHMVYPESA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|