C11H24N2O — CID 62833567
2-(ethylamino)-2-methyl-N-(3-methylbutan-2-yl)propanamide (PubChem CID 62833567) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-N-(3-methylbutan-2-yl)propanamide.
| Compound Name | 2-(ethylamino)-2-methyl-N-(3-methylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 62833567 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 2-(ethylamino)-2-methyl-N-(3-methylbutan-2-yl)propanamide |
| SMILES | CCNC(C)(C)C(=O)NC(C)C(C)C |
| InChI | InChI=1S/C11H24N2O/c1-7-12-11(5,6)10(14)13-9(4)8(2)3/h8-9,12H,7H2,1-6H3,(H,13,14) |
| InChIKey | FDNPCVOHDCYRLS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |