C14H30N2O — CID 114138368
2-(ethylamino)-2-methyl-N-octan-4-ylpropanamide (PubChem CID 114138368) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-N-octan-4-ylpropanamide.
| Compound Name | 2-(ethylamino)-2-methyl-N-octan-4-ylpropanamide |
|---|---|
| PubChem CID | 114138368 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 2-(ethylamino)-2-methyl-N-octan-4-ylpropanamide |
| SMILES | CCCCC(CCC)NC(=O)C(C)(C)NCC |
| InChI | InChI=1S/C14H30N2O/c1-6-9-11-12(10-7-2)16-13(17)14(4,5)15-8-3/h12,15H,6-11H2,1-5H3,(H,16,17) |
| InChIKey | YGTJXHBLQMAYDA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |