2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid

C10H20N2O3 — CID 62835349

IUPAC2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid
SMILESCCNC(C)(C)C(=O)NC(CC)C(=O)O
InChIInChI=1S/C10H20N2O3/c1-5-7(8(13)14)12-9(15)10(3,4)11-6-2/h7,11H,5-6H2,1-4H3,(H,12,15)(H,13,14)
InChIKeyZMIBKRZGQWOPJY-UHFFFAOYSA-N
MW216.28 g/mol
LogP0.35
Rot. Bonds6

About 2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid

2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid (PubChem CID 62835349) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid.

Molecular Properties

Compound Name2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid
PubChem CID62835349
Molecular FormulaC10H20N2O3
Molecular Weight216.28 g/mol
Exact Mass216.15
IUPAC Name2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid
SMILESCCNC(C)(C)C(=O)NC(CC)C(=O)O
InChIInChI=1S/C10H20N2O3/c1-5-7(8(13)14)12-9(15)10(3,4)11-6-2/h7,11H,5-6H2,1-4H3,(H,12,15)(H,13,14)
InChIKeyZMIBKRZGQWOPJY-UHFFFAOYSA-N
XLogP0.35
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.28
LogP ≤ 50.35
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid?
The IUPAC name of 2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid (CID 62835349) is 2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid.
What is the SMILES notation for 2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid?
The canonical SMILES for 2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid is CCNC(C)(C)C(=O)NC(CC)C(=O)O.
What is the InChIKey of 2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid?
The InChIKey is ZMIBKRZGQWOPJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-5-7(8(13)14)12-9(15)10(3,4)11-6-2/h7,11H,5-6H2,1-4H3,(H,12,15)(H,13,14).
What are the key properties of 2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid?
2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid has a molecular weight of 216.28 g/mol, XLogP of 0.35, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(ethylamino)-2-methylpropanoyl]amino]butanoic acid is sourced from PubChem (CID 62835349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).