C8H13NO — CID 123372368
N-(1-methoxyhexa-2,4-dien-2-yl)methanimine (PubChem CID 123372368) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is N-(1-methoxyhexa-2,4-dien-2-yl)methanimine.
| Compound Name | N-(1-methoxyhexa-2,4-dien-2-yl)methanimine |
|---|---|
| PubChem CID | 123372368 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | N-(1-methoxyhexa-2,4-dien-2-yl)methanimine |
| SMILES | C=NC(=CC=CC)COC |
| InChI | InChI=1S/C8H13NO/c1-4-5-6-8(9-2)7-10-3/h4-6H,2,7H2,1,3H3 |
| InChIKey | KVWKKWWYWPFWDN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|