C19H31N3O — CID 135161762
(4Z,6Z)-4-(methylideneamino)-1-[(2S)-2-(1-methylpiperidin-4-yl)pyrrolidin-1-yl]octa-4,6-dien-1-one (PubChem CID 135161762) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is (4Z,6Z)-4-(methylideneamino)-1-[(2S)-2-(1-methylpiperidin-4-yl)pyrrolidin-1-yl]octa-4,6-dien-1-one.
| Compound Name | (4Z,6Z)-4-(methylideneamino)-1-[(2S)-2-(1-methylpiperidin-4-yl)pyrrolidin-1-yl]octa-4,6-dien-1-one |
|---|---|
| PubChem CID | 135161762 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | (4Z,6Z)-4-(methylideneamino)-1-[(2S)-2-(1-methylpiperidin-4-yl)pyrrolidin-1-yl]octa-4,6-dien-1-one |
| SMILES | C=N/C(=C\C=C/C)CCC(=O)N1CCC[C@H]1C1CCN(C)CC1 |
| InChI | InChI=1S/C19H31N3O/c1-4-5-7-17(20-2)9-10-19(23)22-13-6-8-18(22)16-11-14-21(3)15-12-16/h4-5,7,16,18H,2,6,8-15H2,1,3H3/b5-4-,17-7-/t18-/m0/s1 |
| InChIKey | WTWRNVOUHXLFRT-RUZLPNFKSA-N |
| XLogP | 3.26 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|