C12H17NO — CID 146207254
(4Z,6Z)-1-cyclopropyl-4-(methylideneamino)octa-4,6-dien-3-one (PubChem CID 146207254) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (4Z,6Z)-1-cyclopropyl-4-(methylideneamino)octa-4,6-dien-3-one.
| Compound Name | (4Z,6Z)-1-cyclopropyl-4-(methylideneamino)octa-4,6-dien-3-one |
|---|---|
| PubChem CID | 146207254 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (4Z,6Z)-1-cyclopropyl-4-(methylideneamino)octa-4,6-dien-3-one |
| SMILES | C=N/C(=C\C=C/C)C(=O)CCC1CC1 |
| InChI | InChI=1S/C12H17NO/c1-3-4-5-11(13-2)12(14)9-8-10-6-7-10/h3-5,10H,2,6-9H2,1H3/b4-3-,11-5- |
| InChIKey | LWZOBNDBSBBOBJ-RUTRJIIFSA-N |
| XLogP | 2.91 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|