C9H14N2O — CID 129262304
N-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]acetamide (PubChem CID 129262304) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is N-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]acetamide.
| Compound Name | N-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]acetamide |
|---|---|
| PubChem CID | 129262304 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]acetamide |
| SMILES | C=N/C(=C\C=C/C)CNC(C)=O |
| InChI | InChI=1S/C9H14N2O/c1-4-5-6-9(10-3)7-11-8(2)12/h4-6H,3,7H2,1-2H3,(H,11,12)/b5-4-,9-6- |
| InChIKey | KIOFVMQJZLPLKQ-WXOLFVLTSA-N |
| XLogP | 1.28 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|