C10H21N3O — CID 143733482
ethane;2-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]acetohydrazide (PubChem CID 143733482) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is ethane;2-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]acetohydrazide.
| Compound Name | ethane;2-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]acetohydrazide |
|---|---|
| PubChem CID | 143733482 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | ethane;2-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]acetohydrazide |
| SMILES | C/C=C\C=C(/C)NCC(=O)NN.CC |
| InChI | InChI=1S/C8H15N3O.C2H6/c1-3-4-5-7(2)10-6-8(12)11-9;1-2/h3-5,10H,6,9H2,1-2H3,(H,11,12);1-2H3/b4-3-,7-5+; |
| InChIKey | JCGIKYKJBOTIEM-LMMDHOJISA-N |
| XLogP | 1.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|