About 5-oxohexanehydrazide
5-oxohexanehydrazide (PubChem CID 126993835) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 5-oxohexanehydrazide.
Molecular Properties
| Compound Name | 5-oxohexanehydrazide |
| PubChem CID | 126993835 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 5-oxohexanehydrazide |
| SMILES | CC(=O)CCCC(=O)NN |
| InChI | InChI=1S/C6H12N2O2/c1-5(9)3-2-4-6(10)8-7/h2-4,7H2,1H3,(H,8,10) |
| InChIKey | GRBGUPYTFKNEBI-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-oxohexanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxohexanehydrazide?
The IUPAC name of 5-oxohexanehydrazide (CID 126993835) is 5-oxohexanehydrazide.
What is the SMILES notation for 5-oxohexanehydrazide?
The canonical SMILES for 5-oxohexanehydrazide is CC(=O)CCCC(=O)NN.
What is the InChIKey of 5-oxohexanehydrazide?
The InChIKey is GRBGUPYTFKNEBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-5(9)3-2-4-6(10)8-7/h2-4,7H2,1H3,(H,8,10).
What are the key properties of 5-oxohexanehydrazide?
5-oxohexanehydrazide has a molecular weight of 144.17 g/mol, XLogP of -0.26, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxohexanehydrazide is sourced from PubChem (CID 126993835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).