C7H15N3O — CID 149262935
(Z)-6-amino-7-hydrazinylhept-6-en-2-one (PubChem CID 149262935) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is (Z)-6-amino-7-hydrazinylhept-6-en-2-one.
| Compound Name | (Z)-6-amino-7-hydrazinylhept-6-en-2-one |
|---|---|
| PubChem CID | 149262935 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | (Z)-6-amino-7-hydrazinylhept-6-en-2-one |
| SMILES | CC(=O)CCC/C(N)=C/NN |
| InChI | InChI=1S/C7H15N3O/c1-6(11)3-2-4-7(8)5-10-9/h5,10H,2-4,8-9H2,1H3/b7-5- |
| InChIKey | XPOZIHFABUALLS-ALCCZGGFSA-N |
| XLogP | 0.01 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|