C11H19NO2 — CID 166959865
(7Z)-7-(methylaminomethylidene)nonane-2,6-dione (PubChem CID 166959865) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (7Z)-7-(methylaminomethylidene)nonane-2,6-dione.
| Compound Name | (7Z)-7-(methylaminomethylidene)nonane-2,6-dione |
|---|---|
| PubChem CID | 166959865 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (7Z)-7-(methylaminomethylidene)nonane-2,6-dione |
| SMILES | CC/C(=C/NC)C(=O)CCCC(C)=O |
| InChI | InChI=1S/C11H19NO2/c1-4-10(8-12-3)11(14)7-5-6-9(2)13/h8,12H,4-7H2,1-3H3/b10-8- |
| InChIKey | JNRQSHSQXAYEGD-NTMALXAHSA-N |
| XLogP | 1.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|