C12H20O2 — CID 57181280
6-ethyldec-6-ene-2,5-dione (PubChem CID 57181280) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 6-ethyldec-6-ene-2,5-dione.
| Compound Name | 6-ethyldec-6-ene-2,5-dione |
|---|---|
| PubChem CID | 57181280 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 6-ethyldec-6-ene-2,5-dione |
| SMILES | CCCC=C(CC)C(=O)CCC(C)=O |
| InChI | InChI=1S/C12H20O2/c1-4-6-7-11(5-2)12(14)9-8-10(3)13/h7H,4-6,8-9H2,1-3H3 |
| InChIKey | LELCOUSQHLLLTK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|