About [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate
[(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate (PubChem CID 87703227) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate.
Molecular Properties
| Compound Name | [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate |
| PubChem CID | 87703227 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate |
| SMILES | CCC/C=C(/CC)C(=O)OC(=O)/C(=C\CCC)CC |
| InChI | InChI=1S/C16H26O3/c1-5-9-11-13(7-3)15(17)19-16(18)14(8-4)12-10-6-2/h11-12H,5-10H2,1-4H3/b13-11-,14-12- |
| InChIKey | ORYOKKAEFMIUOF-XSYHWHKQSA-N |
| XLogP | 4.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate?
The IUPAC name of [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate (CID 87703227) is [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate.
What is the SMILES notation for [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate?
The canonical SMILES for [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate is CCC/C=C(/CC)C(=O)OC(=O)/C(=C\CCC)CC.
What is the InChIKey of [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate?
The InChIKey is ORYOKKAEFMIUOF-XSYHWHKQSA-N. The full InChI is InChI=1S/C16H26O3/c1-5-9-11-13(7-3)15(17)19-16(18)14(8-4)12-10-6-2/h11-12H,5-10H2,1-4H3/b13-11-,14-12-.
What are the key properties of [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate?
[(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate has a molecular weight of 266.38 g/mol, XLogP of 4.33, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2-ethylhex-2-enoyl] (Z)-2-ethylhex-2-enoate is sourced from PubChem (CID 87703227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).