About 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate
2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate (PubChem CID 173301217) has the molecular formula C32H56O8
and a molecular weight of 568.79 g/mol. Its IUPAC name is 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate.
Molecular Properties
| Compound Name | 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate |
| PubChem CID | 173301217 |
| Molecular Formula | C32H56O8 |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.40 |
| IUPAC Name | 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate |
| SMILES | CCCC=C(CC)C(=O)OOC(=O)C(=CCCC)CC.CCCCC(CC)C(=O)OOC(=O)C(CC)CCCC |
| InChI | InChI=1S/C16H30O4.C16H26O4/c2*1-5-9-11-13(7-3)15(17)19-20-16(18)14(8-4)12-10-6-2/h13-14H,5-12H2,1-4H3;11-12H,5-10H2,1-4H3 |
| InChIKey | SZVHFTQGPUZGQN-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate?
The IUPAC name of 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate (CID 173301217) is 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate.
What is the SMILES notation for 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate?
The canonical SMILES for 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate is CCCC=C(CC)C(=O)OOC(=O)C(=CCCC)CC.CCCCC(CC)C(=O)OOC(=O)C(CC)CCCC.
What is the InChIKey of 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate?
The InChIKey is SZVHFTQGPUZGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O4.C16H26O4/c2*1-5-9-11-13(7-3)15(17)19-20-16(18)14(8-4)12-10-6-2/h13-14H,5-12H2,1-4H3;11-12H,5-10H2,1-4H3.
What are the key properties of 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate?
2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate has a molecular weight of 568.79 g/mol, XLogP of 8.68, 18 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanoyl 2-ethylhexaneperoxoate;2-ethylhex-2-enoyl 2-ethylhex-2-eneperoxoate is sourced from PubChem (CID 173301217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).