About prop-1-en-2-yl 2-ethylhexanoate
prop-1-en-2-yl 2-ethylhexanoate (PubChem CID 131851777) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is prop-1-en-2-yl 2-ethylhexanoate.
Molecular Properties
| Compound Name | prop-1-en-2-yl 2-ethylhexanoate |
| PubChem CID | 131851777 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | prop-1-en-2-yl 2-ethylhexanoate |
| SMILES | C=C(C)OC(=O)C(CC)CCCC |
| InChI | InChI=1S/C11H20O2/c1-5-7-8-10(6-2)11(12)13-9(3)4/h10H,3,5-8H2,1-2,4H3 |
| InChIKey | VMPHTBFBZQELAL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-yl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-yl 2-ethylhexanoate?
The IUPAC name of prop-1-en-2-yl 2-ethylhexanoate (CID 131851777) is prop-1-en-2-yl 2-ethylhexanoate.
What is the SMILES notation for prop-1-en-2-yl 2-ethylhexanoate?
The canonical SMILES for prop-1-en-2-yl 2-ethylhexanoate is C=C(C)OC(=O)C(CC)CCCC.
What is the InChIKey of prop-1-en-2-yl 2-ethylhexanoate?
The InChIKey is VMPHTBFBZQELAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-5-7-8-10(6-2)11(12)13-9(3)4/h10H,3,5-8H2,1-2,4H3.
What are the key properties of prop-1-en-2-yl 2-ethylhexanoate?
prop-1-en-2-yl 2-ethylhexanoate has a molecular weight of 184.28 g/mol, XLogP of 3.28, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-yl 2-ethylhexanoate is sourced from PubChem (CID 131851777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).