About 6-ethyl-4-fluorodeca-3,6-dien-5-one
6-ethyl-4-fluorodeca-3,6-dien-5-one (PubChem CID 139816653) has the molecular formula C12H19FO
and a molecular weight of 198.28 g/mol. Its IUPAC name is 6-ethyl-4-fluorodeca-3,6-dien-5-one.
Molecular Properties
| Compound Name | 6-ethyl-4-fluorodeca-3,6-dien-5-one |
| PubChem CID | 139816653 |
| Molecular Formula | C12H19FO |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 6-ethyl-4-fluorodeca-3,6-dien-5-one |
| SMILES | CCC=C(F)C(=O)C(=CCCC)CC |
| InChI | InChI=1S/C12H19FO/c1-4-7-9-10(6-3)12(14)11(13)8-5-2/h8-9H,4-7H2,1-3H3 |
| InChIKey | RVSFMFAEAMICER-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-4-fluorodeca-3,6-dien-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4-fluorodeca-3,6-dien-5-one?
The IUPAC name of 6-ethyl-4-fluorodeca-3,6-dien-5-one (CID 139816653) is 6-ethyl-4-fluorodeca-3,6-dien-5-one.
What is the SMILES notation for 6-ethyl-4-fluorodeca-3,6-dien-5-one?
The canonical SMILES for 6-ethyl-4-fluorodeca-3,6-dien-5-one is CCC=C(F)C(=O)C(=CCCC)CC.
What is the InChIKey of 6-ethyl-4-fluorodeca-3,6-dien-5-one?
The InChIKey is RVSFMFAEAMICER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19FO/c1-4-7-9-10(6-3)12(14)11(13)8-5-2/h8-9H,4-7H2,1-3H3.
What are the key properties of 6-ethyl-4-fluorodeca-3,6-dien-5-one?
6-ethyl-4-fluorodeca-3,6-dien-5-one has a molecular weight of 198.28 g/mol, XLogP of 3.96, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4-fluorodeca-3,6-dien-5-one is sourced from PubChem (CID 139816653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).