About dibutyltin(2+);bis(2-ethylhex-2-enoate)
dibutyltin(2+);bis(2-ethylhex-2-enoate) (PubChem CID 88626421) has the molecular formula C24H44O4Sn
and a molecular weight of 515.32 g/mol. Its IUPAC name is dibutyltin(2+);bis(2-ethylhex-2-enoate).
Molecular Properties
| Compound Name | dibutyltin(2+);bis(2-ethylhex-2-enoate) |
| PubChem CID | 88626421 |
| Molecular Formula | C24H44O4Sn |
| Molecular Weight | 515.32 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | dibutyltin(2+);bis(2-ethylhex-2-enoate) |
| SMILES | CCCC=C(CC)C(=O)[O-].CCCC=C(CC)C(=O)[O-].CCCC[Sn+2]CCCC |
| InChI | InChI=1S/2C8H14O2.2C4H9.Sn/c2*1-3-5-6-7(4-2)8(9)10;2*1-3-4-2;/h2*6H,3-5H2,1-2H3,(H,9,10);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | UMCKXAYDZPFUAZ-UHFFFAOYSA-L |
| XLogP | 4.87 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.32 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dibutyltin(2+);bis(2-ethylhex-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyltin(2+);bis(2-ethylhex-2-enoate)?
The IUPAC name of dibutyltin(2+);bis(2-ethylhex-2-enoate) (CID 88626421) is dibutyltin(2+);bis(2-ethylhex-2-enoate).
What is the SMILES notation for dibutyltin(2+);bis(2-ethylhex-2-enoate)?
The canonical SMILES for dibutyltin(2+);bis(2-ethylhex-2-enoate) is CCCC=C(CC)C(=O)[O-].CCCC=C(CC)C(=O)[O-].CCCC[Sn+2]CCCC.
What is the InChIKey of dibutyltin(2+);bis(2-ethylhex-2-enoate)?
The InChIKey is UMCKXAYDZPFUAZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H14O2.2C4H9.Sn/c2*1-3-5-6-7(4-2)8(9)10;2*1-3-4-2;/h2*6H,3-5H2,1-2H3,(H,9,10);2*1,3-4H2,2H3;/q;;;;+2/p-2.
What are the key properties of dibutyltin(2+);bis(2-ethylhex-2-enoate)?
dibutyltin(2+);bis(2-ethylhex-2-enoate) has a molecular weight of 515.32 g/mol, XLogP of 4.87, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyltin(2+);bis(2-ethylhex-2-enoate) is sourced from PubChem (CID 88626421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).