About zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate
zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate (PubChem CID 19794979) has the molecular formula C13H25O2SnZn+3
and a molecular weight of 397.44 g/mol. Its IUPAC name is zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate.
Molecular Properties
| Compound Name | zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate |
| PubChem CID | 19794979 |
| Molecular Formula | C13H25O2SnZn+3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate |
| SMILES | CC(=O)/C=C(/C)[O-].CCCC[Sn+2]CCCC.[Zn+2] |
| InChI | InChI=1S/C5H8O2.2C4H9.Sn.Zn/c1-4(6)3-5(2)7;2*1-3-4-2;;/h3,6H,1-2H3;2*1,3-4H2,2H3;;/q;;;2*+2/p-1/b4-3-;;;; |
| InChIKey | HXFBXQGKNNOVDY-PHSMJEINSA-M |
| XLogP | 2.96 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate?
The IUPAC name of zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate (CID 19794979) is zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate.
What is the SMILES notation for zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate?
The canonical SMILES for zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate is CC(=O)/C=C(/C)[O-].CCCC[Sn+2]CCCC.[Zn+2].
What is the InChIKey of zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate?
The InChIKey is HXFBXQGKNNOVDY-PHSMJEINSA-M. The full InChI is InChI=1S/C5H8O2.2C4H9.Sn.Zn/c1-4(6)3-5(2)7;2*1-3-4-2;;/h3,6H,1-2H3;2*1,3-4H2,2H3;;/q;;;2*+2/p-1/b4-3-;;;;.
What are the key properties of zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate?
zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate has a molecular weight of 397.44 g/mol, XLogP of 2.96, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;dibutyltin(2+);(Z)-4-oxopent-2-en-2-olate is sourced from PubChem (CID 19794979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).