C22H40O8Sn — CID 159399728
dibutyltin(2+);bis(3,3-diethoxyprop-2-enoate) (PubChem CID 159399728) has the molecular formula C22H40O8Sn and a molecular weight of 551.27 g/mol. Its IUPAC name is dibutyltin(2+);bis(3,3-diethoxyprop-2-enoate).
| Compound Name | dibutyltin(2+);bis(3,3-diethoxyprop-2-enoate) |
|---|---|
| PubChem CID | 159399728 |
| Molecular Formula | C22H40O8Sn |
| Molecular Weight | 551.27 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | dibutyltin(2+);bis(3,3-diethoxyprop-2-enoate) |
| SMILES | CCCC[Sn+2]CCCC.CCOC(=CC(=O)[O-])OCC.CCOC(=CC(=O)[O-])OCC |
| InChI | InChI=1S/2C7H12O4.2C4H9.Sn/c2*1-3-10-7(11-4-2)5-6(8)9;2*1-3-4-2;/h2*5H,3-4H2,1-2H3,(H,8,9);2*1,3-4H2,2H3;/q;;;;+2/p-2 |
| InChIKey | LNEKUBYRGPDSSJ-UHFFFAOYSA-L |
| XLogP | 2.43 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|