C20H38O4Sn — CID 87234005
(Z)-but-2-enedioate;dibutyltin(2+);3,4-dimethylhexane (PubChem CID 87234005) has the molecular formula C20H38O4Sn and a molecular weight of 461.23 g/mol. Its IUPAC name is (Z)-but-2-enedioate;dibutyltin(2+);3,4-dimethylhexane.
| Compound Name | (Z)-but-2-enedioate;dibutyltin(2+);3,4-dimethylhexane |
|---|---|
| PubChem CID | 87234005 |
| Molecular Formula | C20H38O4Sn |
| Molecular Weight | 461.23 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (Z)-but-2-enedioate;dibutyltin(2+);3,4-dimethylhexane |
| SMILES | CCC(C)C(C)CC.CCCC[Sn+2]CCCC.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C8H18.C4H4O4.2C4H9.Sn/c1-5-7(3)8(4)6-2;5-3(6)1-2-4(7)8;2*1-3-4-2;/h7-8H,5-6H2,1-4H3;1-2H,(H,5,6)(H,7,8);2*1,3-4H2,2H3;/q;;;;+2/p-2/b;2-1-;;; |
| InChIKey | QVMYZPUFCCNGCX-ZMKTYRQVSA-L |
| XLogP | 3.25 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|