About dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate)
dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate) (PubChem CID 70430501) has the molecular formula C30H36O8Sn
and a molecular weight of 643.32 g/mol. Its IUPAC name is dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate).
Molecular Properties
| Compound Name | dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate) |
| PubChem CID | 70430501 |
| Molecular Formula | C30H36O8Sn |
| Molecular Weight | 643.32 g/mol |
| Exact Mass | 644.14 |
| IUPAC Name | dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate) |
| SMILES | CCCC[Sn+2]CCCC.Cc1ccc(OC(=O)/C=C\C(=O)[O-])cc1.Cc1ccc(OC(=O)/C=C\C(=O)[O-])cc1 |
| InChI | InChI=1S/2C11H10O4.2C4H9.Sn/c2*1-8-2-4-9(5-3-8)15-11(14)7-6-10(12)13;2*1-3-4-2;/h2*2-7H,1H3,(H,12,13);2*1,3-4H2,2H3;/q;;;;+2/p-2/b2*7-6-;;; |
| InChIKey | DNPFVHKNSBDYNN-KUAKSMGGSA-L |
| XLogP | 3.54 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 643.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate)?
The IUPAC name of dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate) (CID 70430501) is dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate).
What is the SMILES notation for dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate)?
The canonical SMILES for dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate) is CCCC[Sn+2]CCCC.Cc1ccc(OC(=O)/C=C\C(=O)[O-])cc1.Cc1ccc(OC(=O)/C=C\C(=O)[O-])cc1.
What is the InChIKey of dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate)?
The InChIKey is DNPFVHKNSBDYNN-KUAKSMGGSA-L. The full InChI is InChI=1S/2C11H10O4.2C4H9.Sn/c2*1-8-2-4-9(5-3-8)15-11(14)7-6-10(12)13;2*1-3-4-2;/h2*2-7H,1H3,(H,12,13);2*1,3-4H2,2H3;/q;;;;+2/p-2/b2*7-6-;;;.
What are the key properties of dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate)?
dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate) has a molecular weight of 643.32 g/mol, XLogP of 3.54, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyltin(2+);bis((Z)-4-(4-methylphenoxy)-4-oxobut-2-enoate) is sourced from PubChem (CID 70430501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).