About magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate
magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate (PubChem CID 71301313) has the molecular formula C15H28MgO3
and a molecular weight of 280.69 g/mol. Its IUPAC name is magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate.
Molecular Properties
| Compound Name | magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate |
| PubChem CID | 71301313 |
| Molecular Formula | C15H28MgO3 |
| Molecular Weight | 280.69 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate |
| SMILES | CC(=O)/C=C(/C)[O-].CCCCCCCCCC[O-].[Mg+2] |
| InChI | InChI=1S/C10H21O.C5H8O2.Mg/c1-2-3-4-5-6-7-8-9-10-11;1-4(6)3-5(2)7;/h2-10H2,1H3;3,6H,1-2H3;/q-1;;+2/p-1/b;4-3-; |
| InChIKey | QJXGWPWFRLUOFU-LWFKIUJUSA-M |
| XLogP | 1.95 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.69 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate?
The IUPAC name of magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate (CID 71301313) is magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate.
What is the SMILES notation for magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate?
The canonical SMILES for magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate is CC(=O)/C=C(/C)[O-].CCCCCCCCCC[O-].[Mg+2].
What is the InChIKey of magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate?
The InChIKey is QJXGWPWFRLUOFU-LWFKIUJUSA-M. The full InChI is InChI=1S/C10H21O.C5H8O2.Mg/c1-2-3-4-5-6-7-8-9-10-11;1-4(6)3-5(2)7;/h2-10H2,1H3;3,6H,1-2H3;/q-1;;+2/p-1/b;4-3-;.
What are the key properties of magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate?
magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate has a molecular weight of 280.69 g/mol, XLogP of 1.95, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;decan-1-olate;(Z)-4-oxopent-2-en-2-olate is sourced from PubChem (CID 71301313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).