About gallium (Z)-4-oxopent-2-en-2-olate
gallium (Z)-4-oxopent-2-en-2-olate (PubChem CID 154828612) has the molecular formula C5H7GaO2+2
and a molecular weight of 168.83 g/mol. Its IUPAC name is gallium (Z)-4-oxopent-2-en-2-olate.
Molecular Properties
| Compound Name | gallium (Z)-4-oxopent-2-en-2-olate |
| PubChem CID | 154828612 |
| Molecular Formula | C5H7GaO2+2 |
| Molecular Weight | 168.83 g/mol |
| Exact Mass | 167.97 |
| IUPAC Name | gallium (Z)-4-oxopent-2-en-2-olate |
| SMILES | CC(=O)/C=C(/C)[O-].[Ga+3] |
| InChI | InChI=1S/C5H8O2.Ga/c1-4(6)3-5(2)7;/h3,6H,1-2H3;/q;+3/p-1/b4-3-; |
| InChIKey | PYFGAHKYVJPQNQ-LNKPDPKZSA-M |
| XLogP | -0.54 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.83 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze gallium (Z)-4-oxopent-2-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gallium (Z)-4-oxopent-2-en-2-olate?
The IUPAC name of gallium (Z)-4-oxopent-2-en-2-olate (CID 154828612) is gallium (Z)-4-oxopent-2-en-2-olate.
What is the SMILES notation for gallium (Z)-4-oxopent-2-en-2-olate?
The canonical SMILES for gallium (Z)-4-oxopent-2-en-2-olate is CC(=O)/C=C(/C)[O-].[Ga+3].
What is the InChIKey of gallium (Z)-4-oxopent-2-en-2-olate?
The InChIKey is PYFGAHKYVJPQNQ-LNKPDPKZSA-M. The full InChI is InChI=1S/C5H8O2.Ga/c1-4(6)3-5(2)7;/h3,6H,1-2H3;/q;+3/p-1/b4-3-;.
What are the key properties of gallium (Z)-4-oxopent-2-en-2-olate?
gallium (Z)-4-oxopent-2-en-2-olate has a molecular weight of 168.83 g/mol, XLogP of -0.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gallium (Z)-4-oxopent-2-en-2-olate is sourced from PubChem (CID 154828612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).