About bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+)
bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+) (PubChem CID 6509855) has the molecular formula C10H14O5V
and a molecular weight of 265.16 g/mol. Its IUPAC name is bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+).
Molecular Properties
| Compound Name | bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+) |
| PubChem CID | 6509855 |
| Molecular Formula | C10H14O5V |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+) |
| SMILES | CC(=O)/C=C(\C)[O-].CC(=O)/C=C(\C)[O-].O=[V+2] |
| InChI | InChI=1S/2C5H8O2.O.V/c2*1-4(6)3-5(2)7;;/h2*3,6H,1-2H3;;/q;;;+2/p-2/b2*4-3+;; |
| InChIKey | JFHJZWAQYMGNBE-XHTSQIMGSA-L |
| XLogP | -0.44 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+)?
The IUPAC name of bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+) (CID 6509855) is bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+).
What is the SMILES notation for bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+)?
The canonical SMILES for bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+) is CC(=O)/C=C(\C)[O-].CC(=O)/C=C(\C)[O-].O=[V+2].
What is the InChIKey of bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+)?
The InChIKey is JFHJZWAQYMGNBE-XHTSQIMGSA-L. The full InChI is InChI=1S/2C5H8O2.O.V/c2*1-4(6)3-5(2)7;;/h2*3,6H,1-2H3;;/q;;;+2/p-2/b2*4-3+;;.
What are the key properties of bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+)?
bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+) has a molecular weight of 265.16 g/mol, XLogP of -0.44, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis((E)-4-oxopent-2-en-2-olate);oxovanadium(2+) is sourced from PubChem (CID 6509855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).