About gold(1+);(Z)-4-oxopent-2-en-2-olate
gold(1+);(Z)-4-oxopent-2-en-2-olate (PubChem CID 18374019) has the molecular formula C5H7AuO2
and a molecular weight of 296.08 g/mol. Its IUPAC name is gold(1+);(Z)-4-oxopent-2-en-2-olate.
Molecular Properties
| Compound Name | gold(1+);(Z)-4-oxopent-2-en-2-olate |
| PubChem CID | 18374019 |
| Molecular Formula | C5H7AuO2 |
| Molecular Weight | 296.08 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | gold(1+);(Z)-4-oxopent-2-en-2-olate |
| SMILES | CC(=O)/C=C(/C)[O-].[Au+] |
| InChI | InChI=1S/C5H8O2.Au/c1-4(6)3-5(2)7;/h3,6H,1-2H3;/q;+1/p-1/b4-3-; |
| InChIKey | WYAVBABWQJRPGA-LNKPDPKZSA-M |
| XLogP | -0.16 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.08 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);(Z)-4-oxopent-2-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);(Z)-4-oxopent-2-en-2-olate?
The IUPAC name of gold(1+);(Z)-4-oxopent-2-en-2-olate (CID 18374019) is gold(1+);(Z)-4-oxopent-2-en-2-olate.
What is the SMILES notation for gold(1+);(Z)-4-oxopent-2-en-2-olate?
The canonical SMILES for gold(1+);(Z)-4-oxopent-2-en-2-olate is CC(=O)/C=C(/C)[O-].[Au+].
What is the InChIKey of gold(1+);(Z)-4-oxopent-2-en-2-olate?
The InChIKey is WYAVBABWQJRPGA-LNKPDPKZSA-M. The full InChI is InChI=1S/C5H8O2.Au/c1-4(6)3-5(2)7;/h3,6H,1-2H3;/q;+1/p-1/b4-3-;.
What are the key properties of gold(1+);(Z)-4-oxopent-2-en-2-olate?
gold(1+);(Z)-4-oxopent-2-en-2-olate has a molecular weight of 296.08 g/mol, XLogP of -0.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);(Z)-4-oxopent-2-en-2-olate is sourced from PubChem (CID 18374019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).