About 6-fluorotrideca-5,8-dien-7-one
6-fluorotrideca-5,8-dien-7-one (PubChem CID 85312350) has the molecular formula C13H21FO
and a molecular weight of 212.31 g/mol. Its IUPAC name is 6-fluorotrideca-5,8-dien-7-one.
Molecular Properties
| Compound Name | 6-fluorotrideca-5,8-dien-7-one |
| PubChem CID | 85312350 |
| Molecular Formula | C13H21FO |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 6-fluorotrideca-5,8-dien-7-one |
| SMILES | CCCCC=CC(=O)C(F)=CCCCC |
| InChI | InChI=1S/C13H21FO/c1-3-5-7-9-11-13(15)12(14)10-8-6-4-2/h9-11H,3-8H2,1-2H3 |
| InChIKey | XVPSUMOTGFGCGI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-fluorotrideca-5,8-dien-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorotrideca-5,8-dien-7-one?
The IUPAC name of 6-fluorotrideca-5,8-dien-7-one (CID 85312350) is 6-fluorotrideca-5,8-dien-7-one.
What is the SMILES notation for 6-fluorotrideca-5,8-dien-7-one?
The canonical SMILES for 6-fluorotrideca-5,8-dien-7-one is CCCCC=CC(=O)C(F)=CCCCC.
What is the InChIKey of 6-fluorotrideca-5,8-dien-7-one?
The InChIKey is XVPSUMOTGFGCGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21FO/c1-3-5-7-9-11-13(15)12(14)10-8-6-4-2/h9-11H,3-8H2,1-2H3.
What are the key properties of 6-fluorotrideca-5,8-dien-7-one?
6-fluorotrideca-5,8-dien-7-one has a molecular weight of 212.31 g/mol, XLogP of 4.35, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorotrideca-5,8-dien-7-one is sourced from PubChem (CID 85312350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).