C19H33FO2 — CID 175559432
(14Z)-2-fluorononadeca-2,14-dienoic acid (PubChem CID 175559432) has the molecular formula C19H33FO2 and a molecular weight of 312.47 g/mol. Its IUPAC name is (14Z)-2-fluorononadeca-2,14-dienoic acid.
| Compound Name | (14Z)-2-fluorononadeca-2,14-dienoic acid |
|---|---|
| PubChem CID | 175559432 |
| Molecular Formula | C19H33FO2 |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (14Z)-2-fluorononadeca-2,14-dienoic acid |
| SMILES | CCCC/C=C\CCCCCCCCCCC=C(F)C(=O)O |
| InChI | InChI=1S/C19H33FO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)19(21)22/h5-6,17H,2-4,7-16H2,1H3,(H,21,22)/b6-5-,18-17? |
| InChIKey | WYGYWMKOHIVKJT-SQLAKWGWSA-N |
| XLogP | 6.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|