About carbamic acid;methane;(Z)-tetradec-5-ene
carbamic acid;methane;(Z)-tetradec-5-ene (PubChem CID 174913616) has the molecular formula C16H35NO2
and a molecular weight of 273.46 g/mol. Its IUPAC name is carbamic acid;methane;(Z)-tetradec-5-ene.
Molecular Properties
| Compound Name | carbamic acid;methane;(Z)-tetradec-5-ene |
| PubChem CID | 174913616 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | carbamic acid;methane;(Z)-tetradec-5-ene |
| SMILES | C.CCCC/C=C\CCCCCCCC.NC(=O)O |
| InChI | InChI=1S/C14H28.CH3NO2.CH4/c1-3-5-7-9-11-13-14-12-10-8-6-4-2;2-1(3)4;/h9,11H,3-8,10,12-14H2,1-2H3;2H2,(H,3,4);1H4/b11-9-;; |
| InChIKey | DNWXPQCFYRXRJD-WSELPHFCSA-N |
| XLogP | 5.74 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;methane;(Z)-tetradec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;methane;(Z)-tetradec-5-ene?
The IUPAC name of carbamic acid;methane;(Z)-tetradec-5-ene (CID 174913616) is carbamic acid;methane;(Z)-tetradec-5-ene.
What is the SMILES notation for carbamic acid;methane;(Z)-tetradec-5-ene?
The canonical SMILES for carbamic acid;methane;(Z)-tetradec-5-ene is C.CCCC/C=C\CCCCCCCC.NC(=O)O.
What is the InChIKey of carbamic acid;methane;(Z)-tetradec-5-ene?
The InChIKey is DNWXPQCFYRXRJD-WSELPHFCSA-N. The full InChI is InChI=1S/C14H28.CH3NO2.CH4/c1-3-5-7-9-11-13-14-12-10-8-6-4-2;2-1(3)4;/h9,11H,3-8,10,12-14H2,1-2H3;2H2,(H,3,4);1H4/b11-9-;;.
What are the key properties of carbamic acid;methane;(Z)-tetradec-5-ene?
carbamic acid;methane;(Z)-tetradec-5-ene has a molecular weight of 273.46 g/mol, XLogP of 5.74, 10 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;methane;(Z)-tetradec-5-ene is sourced from PubChem (CID 174913616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).