C10H18N4O3 — CID 162361441
6-N'-(2-methylprop-2-enoyl)hexanedihydrazide (PubChem CID 162361441) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 6-N'-(2-methylprop-2-enoyl)hexanedihydrazide.
| Compound Name | 6-N'-(2-methylprop-2-enoyl)hexanedihydrazide |
|---|---|
| PubChem CID | 162361441 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 6-N'-(2-methylprop-2-enoyl)hexanedihydrazide |
| SMILES | C=C(C)C(=O)NNC(=O)CCCCC(=O)NN |
| InChI | InChI=1S/C10H18N4O3/c1-7(2)10(17)14-13-9(16)6-4-3-5-8(15)12-11/h1,3-6,11H2,2H3,(H,12,15)(H,13,16)(H,14,17) |
| InChIKey | BHGYKAULPUIKLA-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|