C24H42N8O11 — CID 176738787
2-[2-[4-[2-(6-hydrazinyl-6-oxohexanoyl)hydrazinyl]-4-oxobutanoyl]oxyethoxy]ethyl 4-[2-(6-hydrazinyl-6-oxohexanoyl)hydrazinyl]-4-oxobutanoate (PubChem CID 176738787) has the molecular formula C24H42N8O11 and a molecular weight of 618.65 g/mol. Its IUPAC name is 2-[2-[4-[2-(6-hydrazinyl-6-oxohexanoyl)hydrazinyl]-4-oxobutanoyl]oxyethoxy]ethyl 4-[2-(6-hydrazinyl-6-oxohexanoyl)hydrazinyl]-4-oxobutanoate.
| Compound Name | 2-[2-[4-[2-(6-hydrazinyl-6-oxohexanoyl)hydrazinyl]-4-oxobutanoyl]oxyethoxy]ethyl 4-[2-(6-hydrazinyl-6-oxohexanoyl)hydrazinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 176738787 |
| Molecular Formula | C24H42N8O11 |
| Molecular Weight | 618.65 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | 2-[2-[4-[2-(6-hydrazinyl-6-oxohexanoyl)hydrazinyl]-4-oxobutanoyl]oxyethoxy]ethyl 4-[2-(6-hydrazinyl-6-oxohexanoyl)hydrazinyl]-4-oxobutanoate |
| SMILES | NNC(=O)CCCCC(=O)NNC(=O)CCC(=O)OCCOCCOC(=O)CCC(=O)NNC(=O)CCCCC(=O)NN |
| InChI | InChI=1S/C24H42N8O11/c25-27-17(33)5-1-3-7-19(35)29-31-21(37)9-11-23(39)42-15-13-41-14-16-43-24(40)12-10-22(38)32-30-20(36)8-4-2-6-18(34)28-26/h1-16,25-26H2,(H,27,33)(H,28,34)(H,29,35)(H,30,36)(H,31,37)(H,32,38) |
| InChIKey | JYQYQNHWWSKGLE-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 288.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.65 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|