C15H27N3O4 — CID 87662767
tert-butyl N-[6-(2-methylprop-2-enoylamino)hexanoylamino]carbamate (PubChem CID 87662767) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl N-[6-(2-methylprop-2-enoylamino)hexanoylamino]carbamate.
| Compound Name | tert-butyl N-[6-(2-methylprop-2-enoylamino)hexanoylamino]carbamate |
|---|---|
| PubChem CID | 87662767 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | tert-butyl N-[6-(2-methylprop-2-enoylamino)hexanoylamino]carbamate |
| SMILES | C=C(C)C(=O)NCCCCCC(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N3O4/c1-11(2)13(20)16-10-8-6-7-9-12(19)17-18-14(21)22-15(3,4)5/h1,6-10H2,2-5H3,(H,16,20)(H,17,19)(H,18,21) |
| InChIKey | VQUKXMUZQNYKRE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|