C24H38N4O6 — CID 146453732
tert-butyl N-[[14-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-14-oxotetradeca-6,8-diynoyl]amino]carbamate (PubChem CID 146453732) has the molecular formula C24H38N4O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is tert-butyl N-[[14-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-14-oxotetradeca-6,8-diynoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[14-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-14-oxotetradeca-6,8-diynoyl]amino]carbamate |
|---|---|
| PubChem CID | 146453732 |
| Molecular Formula | C24H38N4O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | tert-butyl N-[[14-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]-14-oxotetradeca-6,8-diynoyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)CCCCC#CC#CCCCCC(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38N4O6/c1-23(2,3)33-21(31)27-25-19(29)17-15-13-11-9-7-8-10-12-14-16-18-20(30)26-28-22(32)34-24(4,5)6/h11-18H2,1-6H3,(H,25,29)(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | RIXIELCRXNVGQQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|