About methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide
methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide (PubChem CID 178099887) has the molecular formula C10H23NO2S
and a molecular weight of 221.37 g/mol. Its IUPAC name is methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide.
Molecular Properties
| Compound Name | methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide |
| PubChem CID | 178099887 |
| Molecular Formula | C10H23NO2S |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide |
| SMILES | CCCNC(=O)CCCC(C)=O.CS.[H][H] |
| InChI | InChI=1S/C9H17NO2.CH4S.H2/c1-3-7-10-9(12)6-4-5-8(2)11;1-2;/h3-7H2,1-2H3,(H,10,12);2H,1H3;1H |
| InChIKey | PEIJSPILTXGOHL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide?
The IUPAC name of methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide (CID 178099887) is methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide.
What is the SMILES notation for methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide?
The canonical SMILES for methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide is CCCNC(=O)CCCC(C)=O.CS.[H][H].
What is the InChIKey of methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide?
The InChIKey is PEIJSPILTXGOHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.CH4S.H2/c1-3-7-10-9(12)6-4-5-8(2)11;1-2;/h3-7H2,1-2H3,(H,10,12);2H,1H3;1H.
What are the key properties of methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide?
methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide has a molecular weight of 221.37 g/mol, XLogP of 2.06, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;molecular hydrogen;5-oxo-N-propylhexanamide is sourced from PubChem (CID 178099887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).