About N-butyl-7-oxooctanamide
N-butyl-7-oxooctanamide (PubChem CID 153419892) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is N-butyl-7-oxooctanamide.
Molecular Properties
| Compound Name | N-butyl-7-oxooctanamide |
| PubChem CID | 153419892 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-butyl-7-oxooctanamide |
| SMILES | CCCCNC(=O)CCCCCC(C)=O |
| InChI | InChI=1S/C12H23NO2/c1-3-4-10-13-12(15)9-7-5-6-8-11(2)14/h3-10H2,1-2H3,(H,13,15) |
| InChIKey | VBMYCSSTSGWGME-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-7-oxooctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-7-oxooctanamide?
The IUPAC name of N-butyl-7-oxooctanamide (CID 153419892) is N-butyl-7-oxooctanamide.
What is the SMILES notation for N-butyl-7-oxooctanamide?
The canonical SMILES for N-butyl-7-oxooctanamide is CCCCNC(=O)CCCCCC(C)=O.
What is the InChIKey of N-butyl-7-oxooctanamide?
The InChIKey is VBMYCSSTSGWGME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-3-4-10-13-12(15)9-7-5-6-8-11(2)14/h3-10H2,1-2H3,(H,13,15).
What are the key properties of N-butyl-7-oxooctanamide?
N-butyl-7-oxooctanamide has a molecular weight of 213.32 g/mol, XLogP of 2.44, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-7-oxooctanamide is sourced from PubChem (CID 153419892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).