C10H14N2O — CID 176580787
(2E,4Z)-N-(methylideneamino)-2-prop-1-en-2-ylhexa-2,4-dienamide (PubChem CID 176580787) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (2E,4Z)-N-(methylideneamino)-2-prop-1-en-2-ylhexa-2,4-dienamide.
| Compound Name | (2E,4Z)-N-(methylideneamino)-2-prop-1-en-2-ylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 176580787 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (2E,4Z)-N-(methylideneamino)-2-prop-1-en-2-ylhexa-2,4-dienamide |
| SMILES | C=NNC(=O)/C(=C/C=C\C)C(=C)C |
| InChI | InChI=1S/C10H14N2O/c1-5-6-7-9(8(2)3)10(13)12-11-4/h5-7H,2,4H2,1,3H3,(H,12,13)/b6-5-,9-7+ |
| InChIKey | MHAPQUBBJARZTO-BZWSEGBZSA-N |
| XLogP | 1.80 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|