C12H17NO — CID 142187285
(2E,4Z)-N,2-bis(prop-1-en-2-yl)hexa-2,4-dienamide (PubChem CID 142187285) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (2E,4Z)-N,2-bis(prop-1-en-2-yl)hexa-2,4-dienamide.
| Compound Name | (2E,4Z)-N,2-bis(prop-1-en-2-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 142187285 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2E,4Z)-N,2-bis(prop-1-en-2-yl)hexa-2,4-dienamide |
| SMILES | C=C(C)NC(=O)/C(=C/C=C\C)C(=C)C |
| InChI | InChI=1S/C12H17NO/c1-6-7-8-11(9(2)3)12(14)13-10(4)5/h6-8H,2,4H2,1,3,5H3,(H,13,14)/b7-6-,11-8+ |
| InChIKey | YWKJHJQAAWIWKW-BQGCWICQSA-N |
| XLogP | 2.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|