C12H16N2O4 — CID 129033040
(Z)-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-(1-nitroethenoxy)but-2-enamide (PubChem CID 129033040) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is (Z)-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-(1-nitroethenoxy)but-2-enamide.
| Compound Name | (Z)-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-(1-nitroethenoxy)but-2-enamide |
|---|---|
| PubChem CID | 129033040 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (Z)-N-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-(1-nitroethenoxy)but-2-enamide |
| SMILES | C=C(O/C(=C\C)C(=O)N/C(C)=C/C=C\C)[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O4/c1-5-7-8-9(3)13-12(15)11(6-2)18-10(4)14(16)17/h5-8H,4H2,1-3H3,(H,13,15)/b7-5-,9-8+,11-6- |
| InChIKey | UZYDJLBXKCVRPK-XIBWUEJMSA-N |
| XLogP | 2.25 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|