C10H15N — CID 137427597
(3Z,5Z)-N-prop-1-en-2-ylhepta-1,3,5-trien-2-amine (PubChem CID 137427597) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (3Z,5Z)-N-prop-1-en-2-ylhepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5Z)-N-prop-1-en-2-ylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 137427597 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (3Z,5Z)-N-prop-1-en-2-ylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(C)NC(=C)/C=C\C=C/C |
| InChI | InChI=1S/C10H15N/c1-5-6-7-8-10(4)11-9(2)3/h5-8,11H,2,4H2,1,3H3/b6-5-,8-7- |
| InChIKey | ZJSSPPXRPYNBGW-ISTTXYCBSA-N |
| XLogP | 2.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|