C9H15N3 — CID 148737782
1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-methylguanidine (PubChem CID 148737782) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-methylguanidine.
| Compound Name | 1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 148737782 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-methylguanidine |
| SMILES | C=C(/C=C\C=C/C)N/C(N)=N/C |
| InChI | InChI=1S/C9H15N3/c1-4-5-6-7-8(2)12-9(10)11-3/h4-7H,2H2,1,3H3,(H3,10,11,12)/b5-4-,7-6- |
| InChIKey | OCFUIMHHUZJPCR-RZSVFLSASA-N |
| XLogP | 1.17 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|