C9H17N3 — CID 89170466
1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine (PubChem CID 89170466) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine.
| Compound Name | 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine |
|---|---|
| PubChem CID | 89170466 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine |
| SMILES | C=C/C=C(C)\N=C(/N)N(C)CC |
| InChI | InChI=1S/C9H17N3/c1-5-7-8(3)11-9(10)12(4)6-2/h5,7H,1,6H2,2-4H3,(H2,10,11)/b8-7- |
| InChIKey | ZWUORNPNSMKNAV-FPLPWBNLSA-N |
| XLogP | 1.34 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|