About 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine
1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine (PubChem CID 89170466) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine.
Molecular Properties
| Compound Name | 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine |
| PubChem CID | 89170466 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine |
| SMILES | C=C/C=C(C)\N=C(/N)N(C)CC |
| InChI | InChI=1S/C9H17N3/c1-5-7-8(3)11-9(10)12(4)6-2/h5,7H,1,6H2,2-4H3,(H2,10,11)/b8-7- |
| InChIKey | ZWUORNPNSMKNAV-FPLPWBNLSA-N |
| XLogP | 1.34 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine?
The IUPAC name of 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine (CID 89170466) is 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine.
What is the SMILES notation for 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine?
The canonical SMILES for 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine is C=C/C=C(C)\N=C(/N)N(C)CC.
What is the InChIKey of 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine?
The InChIKey is ZWUORNPNSMKNAV-FPLPWBNLSA-N. The full InChI is InChI=1S/C9H17N3/c1-5-7-8(3)11-9(10)12(4)6-2/h5,7H,1,6H2,2-4H3,(H2,10,11)/b8-7-.
What are the key properties of 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine?
1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine has a molecular weight of 167.26 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-methyl-2-[(2Z)-penta-2,4-dien-2-yl]guanidine is sourced from PubChem (CID 89170466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).